C23H24FNO5 — CID 171967444
benzyl 7-[2-fluoro-4-(methoxymethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate (PubChem CID 171967444) has the molecular formula C23H24FNO5 and a molecular weight of 413.45 g/mol. Its IUPAC name is benzyl 7-[2-fluoro-4-(methoxymethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate.
| Compound Name | benzyl 7-[2-fluoro-4-(methoxymethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
|---|---|
| PubChem CID | 171967444 |
| Molecular Formula | C23H24FNO5 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | benzyl 7-[2-fluoro-4-(methoxymethoxy)phenyl]-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate |
| SMILES | COCOc1ccc(C2=CC3COCC(C2)N3C(=O)OCc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C23H24FNO5/c1-27-15-30-20-7-8-21(22(24)11-20)17-9-18-13-28-14-19(10-17)25(18)23(26)29-12-16-5-3-2-4-6-16/h2-9,11,18-19H,10,12-15H2,1H3 |
| InChIKey | VEWPVTNYIDOTJL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|