C17H20F3NO — CID 171973439
3-[3-methoxy-5-(trifluoromethyl)phenyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene (PubChem CID 171973439) has the molecular formula C17H20F3NO and a molecular weight of 311.35 g/mol. Its IUPAC name is 3-[3-methoxy-5-(trifluoromethyl)phenyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene.
| Compound Name | 3-[3-methoxy-5-(trifluoromethyl)phenyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171973439 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 3-[3-methoxy-5-(trifluoromethyl)phenyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
| SMILES | COc1cc(C2=CC3CCCC(C2)N3C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H20F3NO/c1-21-14-4-3-5-15(21)8-12(7-14)11-6-13(17(18,19)20)10-16(9-11)22-2/h6-7,9-10,14-15H,3-5,8H2,1-2H3 |
| InChIKey | SWKKGGXMLMQPSZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |