C16H19F3N2O — CID 171973574
3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene (PubChem CID 171973574) has the molecular formula C16H19F3N2O and a molecular weight of 312.34 g/mol. Its IUPAC name is 3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene.
| Compound Name | 3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171973574 |
| Molecular Formula | C16H19F3N2O |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 3-[2-methoxy-5-(trifluoromethyl)-3-pyridinyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
| SMILES | COc1ncc(C(F)(F)F)cc1C1=CC2CCCC(C1)N2C |
| InChI | InChI=1S/C16H19F3N2O/c1-21-12-4-3-5-13(21)7-10(6-12)14-8-11(16(17,18)19)9-20-15(14)22-2/h6,8-9,12-13H,3-5,7H2,1-2H3 |
| InChIKey | RXOUHVVHKOHCCI-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |