C18H22F3N — CID 171973542
9-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-azabicyclo[3.3.1]non-2-ene (PubChem CID 171973542) has the molecular formula C18H22F3N and a molecular weight of 309.38 g/mol. Its IUPAC name is 9-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-azabicyclo[3.3.1]non-2-ene.
| Compound Name | 9-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171973542 |
| Molecular Formula | C18H22F3N |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 9-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-9-azabicyclo[3.3.1]non-2-ene |
| SMILES | CN1C2C=C(CCc3cccc(C(F)(F)F)c3)CC1CCC2 |
| InChI | InChI=1S/C18H22F3N/c1-22-16-6-3-7-17(22)12-14(11-16)9-8-13-4-2-5-15(10-13)18(19,20)21/h2,4-5,10-11,16-17H,3,6-9,12H2,1H3 |
| InChIKey | JVBJVVGXPPKIMA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|