C17H19F4N — CID 171973554
3-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene (PubChem CID 171973554) has the molecular formula C17H19F4N and a molecular weight of 313.34 g/mol. Its IUPAC name is 3-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene.
| Compound Name | 3-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171973554 |
| Molecular Formula | C17H19F4N |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
| SMILES | CN1C2C=C(Cc3ccc(F)c(C(F)(F)F)c3)CC1CCC2 |
| InChI | InChI=1S/C17H19F4N/c1-22-13-3-2-4-14(22)9-12(8-13)7-11-5-6-16(18)15(10-11)17(19,20)21/h5-6,8,10,13-14H,2-4,7,9H2,1H3 |
| InChIKey | XJIPYCNZXOKAQO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|