C17H21F2NO — CID 171973802
3-[[3-(difluoromethoxy)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene (PubChem CID 171973802) has the molecular formula C17H21F2NO and a molecular weight of 293.36 g/mol. Its IUPAC name is 3-[[3-(difluoromethoxy)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene.
| Compound Name | 3-[[3-(difluoromethoxy)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171973802 |
| Molecular Formula | C17H21F2NO |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 3-[[3-(difluoromethoxy)phenyl]methyl]-9-methyl-9-azabicyclo[3.3.1]non-2-ene |
| SMILES | CN1C2C=C(Cc3cccc(OC(F)F)c3)CC1CCC2 |
| InChI | InChI=1S/C17H21F2NO/c1-20-14-5-3-6-15(20)10-13(9-14)8-12-4-2-7-16(11-12)21-17(18)19/h2,4,7,9,11,14-15,17H,3,5-6,8,10H2,1H3 |
| InChIKey | BRLRXJAMSVEHOY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|