About 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide
3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171974253) has the molecular formula C18H26O2S
and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
Molecular Properties
| Compound Name | 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| PubChem CID | 171974253 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | O=S1(=O)C2C=C(C3C4CC5CC(C4)CC3C5)CC1CCC2 |
| InChI | InChI=1S/C18H26O2S/c19-21(20)16-2-1-3-17(21)10-15(9-16)18-13-5-11-4-12(7-13)8-14(18)6-11/h9,11-14,16-18H,1-8,10H2 |
| InChIKey | MDSKYEPISKTENN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
The IUPAC name of 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (CID 171974253) is 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
What is the SMILES notation for 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
The canonical SMILES for 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide is O=S1(=O)C2C=C(C3C4CC5CC(C4)CC3C5)CC1CCC2.
What is the InChIKey of 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
The InChIKey is MDSKYEPISKTENN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O2S/c19-21(20)16-2-1-3-17(21)10-15(9-16)18-13-5-11-4-12(7-13)8-14(18)6-11/h9,11-14,16-18H,1-8,10H2.
What are the key properties of 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide?
3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide has a molecular weight of 306.47 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide is sourced from PubChem (CID 171974253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).