C20H30OS — CID 171973358
3-(3,5-dimethyl-1-adamantyl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide (PubChem CID 171973358) has the molecular formula C20H30OS and a molecular weight of 318.53 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-adamantyl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide.
| Compound Name | 3-(3,5-dimethyl-1-adamantyl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
|---|---|
| PubChem CID | 171973358 |
| Molecular Formula | C20H30OS |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.20 |
| IUPAC Name | 3-(3,5-dimethyl-1-adamantyl)-9λ4-thiabicyclo[3.3.1]non-2-ene 9-oxide |
| SMILES | CC12CC3CC(C)(C1)CC(C1=CC4CCCC(C1)S4=O)(C3)C2 |
| InChI | InChI=1S/C20H30OS/c1-18-8-14-9-19(2,11-18)13-20(10-14,12-18)15-6-16-4-3-5-17(7-15)22(16)21/h6,14,16-17H,3-5,7-13H2,1-2H3 |
| InChIKey | TUKYWDPCMQTFJY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|