C19H28O2S — CID 171973364
3-(3,5-dimethyl-1-adamantyl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide (PubChem CID 171973364) has the molecular formula C19H28O2S and a molecular weight of 320.50 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-adamantyl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide.
| Compound Name | 3-(3,5-dimethyl-1-adamantyl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
|---|---|
| PubChem CID | 171973364 |
| Molecular Formula | C19H28O2S |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3-(3,5-dimethyl-1-adamantyl)-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
| SMILES | CC12CC3CC(C)(C1)CC(C1=CC4CCC(C1)S4(=O)=O)(C3)C2 |
| InChI | InChI=1S/C19H28O2S/c1-17-7-13-8-18(2,10-17)12-19(9-13,11-17)14-5-15-3-4-16(6-14)22(15,20)21/h5,13,15-16H,3-4,6-12H2,1-2H3 |
| InChIKey | SGPSBPIMAMEBOZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|