C19H28OS — CID 171974248
3-(3,5-dimethyl-1-adamantyl)-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide (PubChem CID 171974248) has the molecular formula C19H28OS and a molecular weight of 304.50 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-adamantyl)-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide.
| Compound Name | 3-(3,5-dimethyl-1-adamantyl)-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide |
|---|---|
| PubChem CID | 171974248 |
| Molecular Formula | C19H28OS |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-(3,5-dimethyl-1-adamantyl)-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide |
| SMILES | CC12CC3CC(C)(C1)CC(C1=CC4CCC(C1)S4=O)(C3)C2 |
| InChI | InChI=1S/C19H28OS/c1-17-7-13-8-18(2,10-17)12-19(9-13,11-17)14-5-15-3-4-16(6-14)21(15)20/h5,13,15-16H,3-4,6-12H2,1-2H3 |
| InChIKey | QAEPKFWGZZYABW-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|