C20H30S — CID 171974258
3-(3,5-dimethyl-1-adamantyl)-9-thiabicyclo[3.3.1]non-2-ene (PubChem CID 171974258) has the molecular formula C20H30S and a molecular weight of 302.53 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1-adamantyl)-9-thiabicyclo[3.3.1]non-2-ene.
| Compound Name | 3-(3,5-dimethyl-1-adamantyl)-9-thiabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171974258 |
| Molecular Formula | C20H30S |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 3-(3,5-dimethyl-1-adamantyl)-9-thiabicyclo[3.3.1]non-2-ene |
| SMILES | CC12CC3CC(C)(C1)CC(C1=CC4CCCC(C1)S4)(C3)C2 |
| InChI | InChI=1S/C20H30S/c1-18-8-14-9-19(2,11-18)13-20(10-14,12-18)15-6-16-4-3-5-17(7-15)21-16/h6,14,16-17H,3-5,7-13H2,1-2H3 |
| InChIKey | CGNCVIBWQPPOJO-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|