C18H26O2S — CID 171974252
3-(1-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171974252) has the molecular formula C18H26O2S and a molecular weight of 306.47 g/mol. Its IUPAC name is 3-(1-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
| Compound Name | 3-(1-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
|---|---|
| PubChem CID | 171974252 |
| Molecular Formula | C18H26O2S |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 3-(1-adamantyl)-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | O=S1(=O)C2C=C(C34CC5CC(CC(C5)C3)C4)CC1CCC2 |
| InChI | InChI=1S/C18H26O2S/c19-21(20)16-2-1-3-17(21)8-15(7-16)18-9-12-4-13(10-18)6-14(5-12)11-18/h7,12-14,16-17H,1-6,8-11H2 |
| InChIKey | FDEVKUSKXBRPAA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|