C17H26S — CID 6428490
(4E,8E)-4,8-di(butylidene)-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428490) has the molecular formula C17H26S and a molecular weight of 262.46 g/mol. Its IUPAC name is (4E,8E)-4,8-di(butylidene)-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | (4E,8E)-4,8-di(butylidene)-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428490 |
| Molecular Formula | C17H26S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | (4E,8E)-4,8-di(butylidene)-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CCC/C=C1\C2CC3CC1SC(C2)/C3=C/CCC |
| InChI | InChI=1S/C17H26S/c1-3-5-7-14-12-9-13-11-16(14)18-17(10-12)15(13)8-6-4-2/h7-8,12-13,16-17H,3-6,9-11H2,1-2H3/b14-7+,15-8+ |
| InChIKey | OSTAESXMEDMFTD-IROCBMIISA-N |
| XLogP | 5.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|