C15H22S — CID 6428495
(4E,8E)-4,8-di(propylidene)-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428495) has the molecular formula C15H22S and a molecular weight of 234.41 g/mol. Its IUPAC name is (4E,8E)-4,8-di(propylidene)-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | (4E,8E)-4,8-di(propylidene)-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428495 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (4E,8E)-4,8-di(propylidene)-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | CC/C=C1\C2CC3CC1SC(C2)/C3=C/CC |
| InChI | InChI=1S/C15H22S/c1-3-5-12-10-7-11-9-14(12)16-15(8-10)13(11)6-4-2/h5-6,10-11,14-15H,3-4,7-9H2,1-2H3/b12-5+,13-6+ |
| InChIKey | FNHNHDYEQKIOJM-BYDSPXIWSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|