C10H14S — CID 6428498
4-methylidene-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428498) has the molecular formula C10H14S and a molecular weight of 166.29 g/mol. Its IUPAC name is 4-methylidene-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | 4-methylidene-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428498 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 4-methylidene-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | C=C1C2CC3CC(C2)SC1C3 |
| InChI | InChI=1S/C10H14S/c1-6-8-2-7-3-9(5-8)11-10(6)4-7/h7-10H,1-5H2 |
| InChIKey | YBMSHDNMHSMINO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|