C13H18S — CID 6428492
(4E,8E)-4,8-di(ethylidene)-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428492) has the molecular formula C13H18S and a molecular weight of 206.35 g/mol. Its IUPAC name is (4E,8E)-4,8-di(ethylidene)-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | (4E,8E)-4,8-di(ethylidene)-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428492 |
| Molecular Formula | C13H18S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (4E,8E)-4,8-di(ethylidene)-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | C/C=C1\C2CC3CC1SC(C2)/C3=C/C |
| InChI | InChI=1S/C13H18S/c1-3-10-8-5-9-7-12(10)14-13(6-8)11(9)4-2/h3-4,8-9,12-13H,5-7H2,1-2H3/b10-3+,11-4+ |
| InChIKey | DQYPQUPLZVFUDV-HULALXFYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|