C11H16S — CID 6428496
(4E)-4-ethylidene-2-thiatricyclo[3.3.1.13,7]decane (PubChem CID 6428496) has the molecular formula C11H16S and a molecular weight of 180.32 g/mol. Its IUPAC name is (4E)-4-ethylidene-2-thiatricyclo[3.3.1.13,7]decane.
| Compound Name | (4E)-4-ethylidene-2-thiatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 6428496 |
| Molecular Formula | C11H16S |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | (4E)-4-ethylidene-2-thiatricyclo[3.3.1.13,7]decane |
| SMILES | C/C=C1\C2CC3CC(C2)SC1C3 |
| InChI | InChI=1S/C11H16S/c1-2-10-8-3-7-4-9(6-8)12-11(10)5-7/h2,7-9,11H,3-6H2,1H3/b10-2+ |
| InChIKey | OGNJHZQCNYTMRS-WTDSWWLTSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|