C20H34S — CID 163477720
3-[cyclohexyl(cyclohexylsulfanyl)methyl]-6-methylcyclohexene (PubChem CID 163477720) has the molecular formula C20H34S and a molecular weight of 306.56 g/mol. Its IUPAC name is 3-[cyclohexyl(cyclohexylsulfanyl)methyl]-6-methylcyclohexene.
| Compound Name | 3-[cyclohexyl(cyclohexylsulfanyl)methyl]-6-methylcyclohexene |
|---|---|
| PubChem CID | 163477720 |
| Molecular Formula | C20H34S |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 3-[cyclohexyl(cyclohexylsulfanyl)methyl]-6-methylcyclohexene |
| SMILES | CC1C=CC(C(SC2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H34S/c1-16-12-14-18(15-13-16)20(17-8-4-2-5-9-17)21-19-10-6-3-7-11-19/h12,14,16-20H,2-11,13,15H2,1H3 |
| InChIKey | CBWPWKFWGMGIFC-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|