About 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene
3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene (PubChem CID 70994697) has the molecular formula C18H32S
and a molecular weight of 280.52 g/mol. Its IUPAC name is 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene |
| PubChem CID | 70994697 |
| Molecular Formula | C18H32S |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene |
| SMILES | C/C=C\C1SC(CC(C)CCCCCC)=C(C)C1C |
| InChI | InChI=1S/C18H32S/c1-6-8-9-10-12-14(3)13-18-16(5)15(4)17(19-18)11-7-2/h7,11,14-15,17H,6,8-10,12-13H2,1-5H3/b11-7- |
| InChIKey | OUFDJXYSYMEHIZ-XFFZJAGNSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene?
The IUPAC name of 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene (CID 70994697) is 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene.
What is the SMILES notation for 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene?
The canonical SMILES for 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene is C/C=C\C1SC(CC(C)CCCCCC)=C(C)C1C.
What is the InChIKey of 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene?
The InChIKey is OUFDJXYSYMEHIZ-XFFZJAGNSA-N. The full InChI is InChI=1S/C18H32S/c1-6-8-9-10-12-14(3)13-18-16(5)15(4)17(19-18)11-7-2/h7,11,14-15,17H,6,8-10,12-13H2,1-5H3/b11-7-.
What are the key properties of 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene?
3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene has a molecular weight of 280.52 g/mol, XLogP of 6.58, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene is sourced from PubChem (CID 70994697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).