C18H32S — CID 70994697
3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene (PubChem CID 70994697) has the molecular formula C18H32S and a molecular weight of 280.52 g/mol. Its IUPAC name is 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene.
| Compound Name | 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 70994697 |
| Molecular Formula | C18H32S |
| Molecular Weight | 280.52 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 3,4-dimethyl-5-(2-methyloctyl)-2-[(Z)-prop-1-enyl]-2,3-dihydrothiophene |
| SMILES | C/C=C\C1SC(CC(C)CCCCCC)=C(C)C1C |
| InChI | InChI=1S/C18H32S/c1-6-8-9-10-12-14(3)13-18-16(5)15(4)17(19-18)11-7-2/h7,11,14-15,17H,6,8-10,12-13H2,1-5H3/b11-7- |
| InChIKey | OUFDJXYSYMEHIZ-XFFZJAGNSA-N |
| XLogP | 6.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.52 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|