C17H17NO2S — CID 171974406
3-isoquinolin-4-yl-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide (PubChem CID 171974406) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-isoquinolin-4-yl-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide.
| Compound Name | 3-isoquinolin-4-yl-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
|---|---|
| PubChem CID | 171974406 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-isoquinolin-4-yl-9λ6-thiabicyclo[3.3.1]non-2-ene 9,9-dioxide |
| SMILES | O=S1(=O)C2C=C(c3cncc4ccccc34)CC1CCC2 |
| InChI | InChI=1S/C17H17NO2S/c19-21(20)14-5-3-6-15(21)9-13(8-14)17-11-18-10-12-4-1-2-7-16(12)17/h1-2,4,7-8,10-11,14-15H,3,5-6,9H2 |
| InChIKey | ARIMFGHCBKBWQN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |