C17H13NOS2 — CID 171976609
10-pyridin-2-yl-5H-thieno[2,3-c][2]benzothiepin-10-ol (PubChem CID 171976609) has the molecular formula C17H13NOS2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 10-pyridin-2-yl-5H-thieno[2,3-c][2]benzothiepin-10-ol.
| Compound Name | 10-pyridin-2-yl-5H-thieno[2,3-c][2]benzothiepin-10-ol |
|---|---|
| PubChem CID | 171976609 |
| Molecular Formula | C17H13NOS2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 10-pyridin-2-yl-5H-thieno[2,3-c][2]benzothiepin-10-ol |
| SMILES | OC1(c2ccccn2)c2ccccc2CSc2sccc21 |
| InChI | InChI=1S/C17H13NOS2/c19-17(15-7-3-4-9-18-15)13-6-2-1-5-12(13)11-21-16-14(17)8-10-20-16/h1-10,19H,11H2 |
| InChIKey | WOFIEAAPFNJROM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |