C26H35N3O6 — CID 171976842
propan-2-yl N,N-bis[2-[(2,3-dimethylphenyl)carbamoyloxy]ethyl]carbamate (PubChem CID 171976842) has the molecular formula C26H35N3O6 and a molecular weight of 485.58 g/mol. Its IUPAC name is propan-2-yl N,N-bis[2-[(2,3-dimethylphenyl)carbamoyloxy]ethyl]carbamate.
| Compound Name | propan-2-yl N,N-bis[2-[(2,3-dimethylphenyl)carbamoyloxy]ethyl]carbamate |
|---|---|
| PubChem CID | 171976842 |
| Molecular Formula | C26H35N3O6 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.25 |
| IUPAC Name | propan-2-yl N,N-bis[2-[(2,3-dimethylphenyl)carbamoyloxy]ethyl]carbamate |
| SMILES | Cc1cccc(NC(=O)OCCN(CCOC(=O)Nc2cccc(C)c2C)C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C26H35N3O6/c1-17(2)35-26(32)29(13-15-33-24(30)27-22-11-7-9-18(3)20(22)5)14-16-34-25(31)28-23-12-8-10-19(4)21(23)6/h7-12,17H,13-16H2,1-6H3,(H,27,30)(H,28,31) |
| InChIKey | LTYFPKKQAPMJBJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|