C20H19F2N3O2 — CID 171978040
1-(4-fluorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pyrrolidine-2,3-dione (PubChem CID 171978040) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pyrrolidine-2,3-dione.
| Compound Name | 1-(4-fluorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 171978040 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-(4-fluorophenyl)-5-[4-(4-fluorophenyl)piperazin-1-yl]pyrrolidine-2,3-dione |
| SMILES | O=C1CC(N2CCN(c3ccc(F)cc3)CC2)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C20H19F2N3O2/c21-14-1-5-16(6-2-14)23-9-11-24(12-10-23)19-13-18(26)20(27)25(19)17-7-3-15(22)4-8-17/h1-8,19H,9-13H2 |
| InChIKey | DFYSYJNGDAWTNS-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|