C25H22ClN3O3S — CID 171978297
ethyl 5-amino-7-(4-chlorophenyl)-1-ethylsulfanyl-4-oxo-3-phenylphthalazine-6-carboxylate (PubChem CID 171978297) has the molecular formula C25H22ClN3O3S and a molecular weight of 479.99 g/mol. Its IUPAC name is ethyl 5-amino-7-(4-chlorophenyl)-1-ethylsulfanyl-4-oxo-3-phenylphthalazine-6-carboxylate.
| Compound Name | ethyl 5-amino-7-(4-chlorophenyl)-1-ethylsulfanyl-4-oxo-3-phenylphthalazine-6-carboxylate |
|---|---|
| PubChem CID | 171978297 |
| Molecular Formula | C25H22ClN3O3S |
| Molecular Weight | 479.99 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | ethyl 5-amino-7-(4-chlorophenyl)-1-ethylsulfanyl-4-oxo-3-phenylphthalazine-6-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2)cc2c(SCC)nn(-c3ccccc3)c(=O)c2c1N |
| InChI | InChI=1S/C25H22ClN3O3S/c1-3-32-25(31)21-18(15-10-12-16(26)13-11-15)14-19-20(22(21)27)24(30)29(28-23(19)33-4-2)17-8-6-5-7-9-17/h5-14H,3-4,27H2,1-2H3 |
| InChIKey | ASWJSLXLTQYWIB-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.99 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|