C22H18N4O4S — CID 171978648
4-[(Z)-[(Z)-(3-benzyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-6-nitrobenzene-1,3-diol (PubChem CID 171978648) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is 4-[(Z)-[(Z)-(3-benzyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-6-nitrobenzene-1,3-diol.
| Compound Name | 4-[(Z)-[(Z)-(3-benzyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-6-nitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 171978648 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-[(Z)-[(Z)-(3-benzyl-6-methyl-1,3-benzothiazol-2-ylidene)hydrazinylidene]methyl]-6-nitrobenzene-1,3-diol |
| SMILES | Cc1ccc2c(c1)s/c(=N\N=C/c1cc([N+](=O)[O-])c(O)cc1O)n2Cc1ccccc1 |
| InChI | InChI=1S/C22H18N4O4S/c1-14-7-8-17-21(9-14)31-22(25(17)13-15-5-3-2-4-6-15)24-23-12-16-10-18(26(29)30)20(28)11-19(16)27/h2-12,27-28H,13H2,1H3/b23-12-,24-22- |
| InChIKey | FVUZMFRETSDKBJ-PCQKPEDNSA-N |
| XLogP | 4.31 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|