C19H16N4O — CID 171982843
N'-(4-methylquinolin-2-yl)-1H-indole-7-carbohydrazide (PubChem CID 171982843) has the molecular formula C19H16N4O and a molecular weight of 316.36 g/mol. Its IUPAC name is N'-(4-methylquinolin-2-yl)-1H-indole-7-carbohydrazide.
| Compound Name | N'-(4-methylquinolin-2-yl)-1H-indole-7-carbohydrazide |
|---|---|
| PubChem CID | 171982843 |
| Molecular Formula | C19H16N4O |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | N'-(4-methylquinolin-2-yl)-1H-indole-7-carbohydrazide |
| SMILES | Cc1cc(NNC(=O)c2cccc3cc[nH]c23)nc2ccccc12 |
| InChI | InChI=1S/C19H16N4O/c1-12-11-17(21-16-8-3-2-6-14(12)16)22-23-19(24)15-7-4-5-13-9-10-20-18(13)15/h2-11,20H,1H3,(H,21,22)(H,23,24) |
| InChIKey | SUKFYZDXXMRZSW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|