C18H16FN3O3S — CID 7600170
2-(4-fluorophenyl)sulfonyl-N'-(4-methylquinolin-2-yl)acetohydrazide (PubChem CID 7600170) has the molecular formula C18H16FN3O3S and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)sulfonyl-N'-(4-methylquinolin-2-yl)acetohydrazide.
| Compound Name | 2-(4-fluorophenyl)sulfonyl-N'-(4-methylquinolin-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 7600170 |
| Molecular Formula | C18H16FN3O3S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-(4-fluorophenyl)sulfonyl-N'-(4-methylquinolin-2-yl)acetohydrazide |
| SMILES | Cc1cc(NNC(=O)CS(=O)(=O)c2ccc(F)cc2)nc2ccccc12 |
| InChI | InChI=1S/C18H16FN3O3S/c1-12-10-17(20-16-5-3-2-4-15(12)16)21-22-18(23)11-26(24,25)14-8-6-13(19)7-9-14/h2-10H,11H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | YLQKAGNRFMKZKX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|