C18H15FN4O4S — CID 127043320
N-[(4-fluorophenyl)carbamoyl]-2-(3-methylquinoxalin-2-yl)sulfonylacetamide (PubChem CID 127043320) has the molecular formula C18H15FN4O4S and a molecular weight of 402.41 g/mol. Its IUPAC name is N-[(4-fluorophenyl)carbamoyl]-2-(3-methylquinoxalin-2-yl)sulfonylacetamide.
| Compound Name | N-[(4-fluorophenyl)carbamoyl]-2-(3-methylquinoxalin-2-yl)sulfonylacetamide |
|---|---|
| PubChem CID | 127043320 |
| Molecular Formula | C18H15FN4O4S |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N-[(4-fluorophenyl)carbamoyl]-2-(3-methylquinoxalin-2-yl)sulfonylacetamide |
| SMILES | Cc1nc2ccccc2nc1S(=O)(=O)CC(=O)NC(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN4O4S/c1-11-17(22-15-5-3-2-4-14(15)20-11)28(26,27)10-16(24)23-18(25)21-13-8-6-12(19)7-9-13/h2-9H,10H2,1H3,(H2,21,23,24,25) |
| InChIKey | AWVSELISDJPTGI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |