C18H18N2O3 — CID 171983291
N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]spiro[2.3]hexane-2-carboxamide (PubChem CID 171983291) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]spiro[2.3]hexane-2-carboxamide.
| Compound Name | N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]spiro[2.3]hexane-2-carboxamide |
|---|---|
| PubChem CID | 171983291 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[(Z)-1-(1,3-dioxoinden-2-yl)ethylideneamino]spiro[2.3]hexane-2-carboxamide |
| SMILES | C/C(=N/NC(=O)C1CC12CCC2)C1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N2O3/c1-10(19-20-17(23)13-9-18(13)7-4-8-18)14-15(21)11-5-2-3-6-12(11)16(14)22/h2-3,5-6,13-14H,4,7-9H2,1H3,(H,20,23)/b19-10- |
| InChIKey | FPZHHPCCYOLDGB-GRSHGNNSSA-N |
| XLogP | 2.36 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|