C20H19Cl2N3O3 — CID 171984075
1-[1-(2,4-dichlorophenyl)-8,9-dimethoxy-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]ethanone (PubChem CID 171984075) has the molecular formula C20H19Cl2N3O3 and a molecular weight of 420.30 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)-8,9-dimethoxy-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]ethanone.
| Compound Name | 1-[1-(2,4-dichlorophenyl)-8,9-dimethoxy-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 171984075 |
| Molecular Formula | C20H19Cl2N3O3 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)-8,9-dimethoxy-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinolin-3-yl]ethanone |
| SMILES | COc1cc2c(cc1OC)C1N(CC2)C(C(C)=O)=NN1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl2N3O3/c1-11(26)19-23-25(16-5-4-13(21)9-15(16)22)20-14-10-18(28-3)17(27-2)8-12(14)6-7-24(19)20/h4-5,8-10,20H,6-7H2,1-3H3 |
| InChIKey | LGZPSASCEZRWFJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |