C24H20Cl2N4O4 — CID 42545228
(10bS)-3-(2,4-dichlorophenyl)-8,9-dimethoxy-1-(4-nitrophenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinoline (PubChem CID 42545228) has the molecular formula C24H20Cl2N4O4 and a molecular weight of 499.35 g/mol. Its IUPAC name is (10bS)-3-(2,4-dichlorophenyl)-8,9-dimethoxy-1-(4-nitrophenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinoline.
| Compound Name | (10bS)-3-(2,4-dichlorophenyl)-8,9-dimethoxy-1-(4-nitrophenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinoline |
|---|---|
| PubChem CID | 42545228 |
| Molecular Formula | C24H20Cl2N4O4 |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | (10bS)-3-(2,4-dichlorophenyl)-8,9-dimethoxy-1-(4-nitrophenyl)-6,10b-dihydro-5H-[1,2,4]triazolo[3,4-a]isoquinoline |
| SMILES | COc1cc2c(cc1OC)[C@H]1N(CC2)C(c2ccc(Cl)cc2Cl)=NN1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20Cl2N4O4/c1-33-21-11-14-9-10-28-23(18-8-3-15(25)12-20(18)26)27-29(24(28)19(14)13-22(21)34-2)16-4-6-17(7-5-16)30(31)32/h3-8,11-13,24H,9-10H2,1-2H3/t24-/m0/s1 |
| InChIKey | XOLOHUSZEUMZBZ-DEOSSOPVSA-N |
| XLogP | 5.66 |
| TPSA | 80.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|