About methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate
methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate (PubChem CID 171984511) has the molecular formula C27H24NO3P
and a molecular weight of 441.47 g/mol. Its IUPAC name is methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
| PubChem CID | 171984511 |
| Molecular Formula | C27H24NO3P |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate |
| SMILES | COC(=O)/C(=C\c1ccc(C)o1)N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H24NO3P/c1-21-18-19-22(31-21)20-26(27(29)30-2)28-32(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-20H,1-2H3/b26-20+ |
| InChIKey | XICAMWXORPAOFM-LHLOQNFPSA-N |
| XLogP | 5.28 |
| TPSA | 51.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate?
The IUPAC name of methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate (CID 171984511) is methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate.
What is the SMILES notation for methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate?
The canonical SMILES for methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate is COC(=O)/C(=C\c1ccc(C)o1)N=P(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate?
The InChIKey is XICAMWXORPAOFM-LHLOQNFPSA-N. The full InChI is InChI=1S/C27H24NO3P/c1-21-18-19-22(31-21)20-26(27(29)30-2)28-32(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-20H,1-2H3/b26-20+.
What are the key properties of methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate?
methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate has a molecular weight of 441.47 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-3-(5-methylfuran-2-yl)-2-[(triphenyl-λ5-phosphanylidene)amino]prop-2-enoate is sourced from PubChem (CID 171984511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).