C20H21N7 — CID 17198478
1-benzyl-3-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole (PubChem CID 17198478) has the molecular formula C20H21N7 and a molecular weight of 359.44 g/mol. Its IUPAC name is 1-benzyl-3-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole.
| Compound Name | 1-benzyl-3-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole |
|---|---|
| PubChem CID | 17198478 |
| Molecular Formula | C20H21N7 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 1-benzyl-3-(3,5-dimethyl-1,2,4-triazol-4-yl)-2,4-dihydro-[1,3,5]triazino[1,2-a]benzimidazole |
| SMILES | Cc1nnc(C)n1N1CN(Cc2ccccc2)c2nc3ccccc3n2C1 |
| InChI | InChI=1S/C20H21N7/c1-15-22-23-16(2)27(15)25-13-24(12-17-8-4-3-5-9-17)20-21-18-10-6-7-11-19(18)26(20)14-25/h3-11H,12-14H2,1-2H3 |
| InChIKey | CGRKOBAUKJDGAS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |