C21H21N9 — CID 17190685
4-(3,5-dimethyl-1,2,4-triazol-4-yl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene (PubChem CID 17190685) has the molecular formula C21H21N9 and a molecular weight of 399.46 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1,2,4-triazol-4-yl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene.
| Compound Name | 4-(3,5-dimethyl-1,2,4-triazol-4-yl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
|---|---|
| PubChem CID | 17190685 |
| Molecular Formula | C21H21N9 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 4-(3,5-dimethyl-1,2,4-triazol-4-yl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
| SMILES | Cc1nnc(C)n1N1CN=C2NC(c3ccccc3)n3c(nc4ccccc43)N2C1 |
| InChI | InChI=1S/C21H21N9/c1-14-25-26-15(2)30(14)27-12-22-20-24-19(16-8-4-3-5-9-16)29-18-11-7-6-10-17(18)23-21(29)28(20)13-27/h3-11,19H,12-13H2,1-2H3,(H,22,24) |
| InChIKey | HXYGUPNUKFTLOS-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |