C24H28ClN7O — CID 28629040
4-[3-[(9R)-9-(4-chlorophenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]propyl]morpholine (PubChem CID 28629040) has the molecular formula C24H28ClN7O and a molecular weight of 465.99 g/mol. Its IUPAC name is 4-[3-[(9R)-9-(4-chlorophenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]propyl]morpholine.
| Compound Name | 4-[3-[(9R)-9-(4-chlorophenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]propyl]morpholine |
|---|---|
| PubChem CID | 28629040 |
| Molecular Formula | C24H28ClN7O |
| Molecular Weight | 465.99 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 4-[3-[(9R)-9-(4-chlorophenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]propyl]morpholine |
| SMILES | Clc1ccc([C@@H]2NC3=NCN(CCCN4CCOCC4)CN3c3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C24H28ClN7O/c25-19-8-6-18(7-9-19)22-28-23-26-16-30(11-3-10-29-12-14-33-15-13-29)17-31(23)24-27-20-4-1-2-5-21(20)32(22)24/h1-2,4-9,22H,3,10-17H2,(H,26,28)/t22-/m1/s1 |
| InChIKey | BZEOZTIPLZXOOL-JOCHJYFZSA-N |
| XLogP | 2.96 |
| TPSA | 61.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.99 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |