C24H26N6O2 — CID 66507528
4-cyclopentyl-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene (PubChem CID 66507528) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-cyclopentyl-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene.
| Compound Name | 4-cyclopentyl-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
|---|---|
| PubChem CID | 66507528 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 4-cyclopentyl-9-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
| SMILES | c1ccc2c(c1)nc1n2C(c2ccc3c(c2)OCCO3)NC2=NCN(C3CCCC3)CN21 |
| InChI | InChI=1S/C24H26N6O2/c1-2-6-17(5-1)28-14-25-23-27-22(16-9-10-20-21(13-16)32-12-11-31-20)30-19-8-4-3-7-18(19)26-24(30)29(23)15-28/h3-4,7-10,13,17,22H,1-2,5-6,11-12,14-15H2,(H,25,27) |
| InChIKey | LLRWBJJGOZXGNU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |