C22H20N6O — CID 28629029
(9R)-4-(furan-2-ylmethyl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene (PubChem CID 28629029) has the molecular formula C22H20N6O and a molecular weight of 384.44 g/mol. Its IUPAC name is (9R)-4-(furan-2-ylmethyl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene.
| Compound Name | (9R)-4-(furan-2-ylmethyl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
|---|---|
| PubChem CID | 28629029 |
| Molecular Formula | C22H20N6O |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | (9R)-4-(furan-2-ylmethyl)-9-phenyl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
| SMILES | c1ccc([C@@H]2NC3=NCN(Cc4ccco4)CN3c3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C22H20N6O/c1-2-7-16(8-3-1)20-25-21-23-14-26(13-17-9-6-12-29-17)15-27(21)22-24-18-10-4-5-11-19(18)28(20)22/h1-12,20H,13-15H2,(H,23,25)/t20-/m1/s1 |
| InChIKey | UNHXJBDFMBFGCU-HXUWFJFHSA-N |
| XLogP | 3.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |