C24H31N7O2 — CID 29104150
3-[(9R)-9-(3,4-dimethoxyphenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]-N,N-dimethylpropan-1-amine (PubChem CID 29104150) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 3-[(9R)-9-(3,4-dimethoxyphenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(9R)-9-(3,4-dimethoxyphenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 29104150 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 3-[(9R)-9-(3,4-dimethoxyphenyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-4-yl]-N,N-dimethylpropan-1-amine |
| SMILES | COc1ccc([C@@H]2NC3=NCN(CCCN(C)C)CN3c3nc4ccccc4n32)cc1OC |
| InChI | InChI=1S/C24H31N7O2/c1-28(2)12-7-13-29-15-25-23-27-22(17-10-11-20(32-3)21(14-17)33-4)31-19-9-6-5-8-18(19)26-24(31)30(23)16-29/h5-6,8-11,14,22H,7,12-13,15-16H2,1-4H3,(H,25,27)/t22-/m1/s1 |
| InChIKey | RTAJDJBXXLJCGB-JOCHJYFZSA-N |
| XLogP | 2.55 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |