C21H24N6O — CID 17198582
9-(4-methoxyphenyl)-4-propan-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene (PubChem CID 17198582) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-4-propan-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene.
| Compound Name | 9-(4-methoxyphenyl)-4-propan-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
|---|---|
| PubChem CID | 17198582 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 9-(4-methoxyphenyl)-4-propan-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
| SMILES | COc1ccc(C2NC3=NCN(C(C)C)CN3c3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C21H24N6O/c1-14(2)25-12-22-20-24-19(15-8-10-16(28-3)11-9-15)27-18-7-5-4-6-17(18)23-21(27)26(20)13-25/h4-11,14,19H,12-13H2,1-3H3,(H,22,24) |
| InChIKey | LDOPZEVSAVSEEI-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |