C19H16ClN9 — CID 17190703
9-(4-chlorophenyl)-4-(1,2,4-triazol-4-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene (PubChem CID 17190703) has the molecular formula C19H16ClN9 and a molecular weight of 405.85 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-4-(1,2,4-triazol-4-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene.
| Compound Name | 9-(4-chlorophenyl)-4-(1,2,4-triazol-4-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
|---|---|
| PubChem CID | 17190703 |
| Molecular Formula | C19H16ClN9 |
| Molecular Weight | 405.85 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 9-(4-chlorophenyl)-4-(1,2,4-triazol-4-yl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
| SMILES | Clc1ccc(C2NC3=NCN(n4cnnc4)CN3c3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C19H16ClN9/c20-14-7-5-13(6-8-14)17-25-18-21-9-27(26-10-22-23-11-26)12-28(18)19-24-15-3-1-2-4-16(15)29(17)19/h1-8,10-11,17H,9,12H2,(H,21,25) |
| InChIKey | VIRNJAFEEYKVKQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 79.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.85 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |