C25H26N8 — CID 28629197
N,N-dimethyl-4-[(9S)-4-(pyridin-2-ylmethyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-9-yl]aniline (PubChem CID 28629197) has the molecular formula C25H26N8 and a molecular weight of 438.54 g/mol. Its IUPAC name is N,N-dimethyl-4-[(9S)-4-(pyridin-2-ylmethyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-9-yl]aniline.
| Compound Name | N,N-dimethyl-4-[(9S)-4-(pyridin-2-ylmethyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-9-yl]aniline |
|---|---|
| PubChem CID | 28629197 |
| Molecular Formula | C25H26N8 |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N,N-dimethyl-4-[(9S)-4-(pyridin-2-ylmethyl)-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaen-9-yl]aniline |
| SMILES | CN(C)c1ccc([C@H]2NC3=NCN(Cc4ccccn4)CN3c3nc4ccccc4n32)cc1 |
| InChI | InChI=1S/C25H26N8/c1-30(2)20-12-10-18(11-13-20)23-29-24-27-16-31(15-19-7-5-6-14-26-19)17-32(24)25-28-21-8-3-4-9-22(21)33(23)25/h3-14,23H,15-17H2,1-2H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | DLWSAZSWJRGBFC-QHCPKHFHSA-N |
| XLogP | 3.24 |
| TPSA | 64.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |