C21H23N7 — CID 16653774
4-(pyridin-2-ylmethyl)spiro[2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene-9,1'-cyclopentane] (PubChem CID 16653774) has the molecular formula C21H23N7 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-(pyridin-2-ylmethyl)spiro[2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene-9,1'-cyclopentane].
| Compound Name | 4-(pyridin-2-ylmethyl)spiro[2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene-9,1'-cyclopentane] |
|---|---|
| PubChem CID | 16653774 |
| Molecular Formula | C21H23N7 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-(pyridin-2-ylmethyl)spiro[2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene-9,1'-cyclopentane] |
| SMILES | c1ccc(CN2CN=C3NC4(CCCC4)n4c(nc5ccccc54)N3C2)nc1 |
| InChI | InChI=1S/C21H23N7/c1-2-9-18-17(8-1)24-20-27-15-26(13-16-7-3-6-12-22-16)14-23-19(27)25-21(28(18)20)10-4-5-11-21/h1-3,6-9,12H,4-5,10-11,13-15H2,(H,23,25) |
| InChIKey | SVAYOSWCSZMEGO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |