C21H19N7S — CID 28629800
(9R)-4-(pyridin-3-ylmethyl)-9-thiophen-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene (PubChem CID 28629800) has the molecular formula C21H19N7S and a molecular weight of 401.50 g/mol. Its IUPAC name is (9R)-4-(pyridin-3-ylmethyl)-9-thiophen-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene.
| Compound Name | (9R)-4-(pyridin-3-ylmethyl)-9-thiophen-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
|---|---|
| PubChem CID | 28629800 |
| Molecular Formula | C21H19N7S |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (9R)-4-(pyridin-3-ylmethyl)-9-thiophen-2-yl-2,4,6,8,10,17-hexazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),6,11,13,15-pentaene |
| SMILES | c1cncc(CN2CN=C3N[C@@H](c4cccs4)n4c(nc5ccccc54)N3C2)c1 |
| InChI | InChI=1S/C21H19N7S/c1-2-7-17-16(6-1)24-21-27-14-26(12-15-5-3-9-22-11-15)13-23-20(27)25-19(28(17)21)18-8-4-10-29-18/h1-11,19H,12-14H2,(H,23,25)/t19-/m1/s1 |
| InChIKey | JOFXUNJXQNTCRM-LJQANCHMSA-N |
| XLogP | 3.24 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |