C11H8ClN3 — CID 171988497
10-chloro-4-methyl-[1,2,4]triazino[4,5-a]indole (PubChem CID 171988497) has the molecular formula C11H8ClN3 and a molecular weight of 217.66 g/mol. Its IUPAC name is 10-chloro-4-methyl-[1,2,4]triazino[4,5-a]indole.
| Compound Name | 10-chloro-4-methyl-[1,2,4]triazino[4,5-a]indole |
|---|---|
| PubChem CID | 171988497 |
| Molecular Formula | C11H8ClN3 |
| Molecular Weight | 217.66 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | 10-chloro-4-methyl-[1,2,4]triazino[4,5-a]indole |
| SMILES | Cc1nncc2c(Cl)c3ccccc3n12 |
| InChI | InChI=1S/C11H8ClN3/c1-7-14-13-6-10-11(12)8-4-2-3-5-9(8)15(7)10/h2-6H,1H3 |
| InChIKey | UQXALAKCCFJWLL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.66 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |