C26H19N3O — CID 171989629
2-benzoyl-5-benzyl-1H-pyrido[4,3-b]indole-1-carbonitrile (PubChem CID 171989629) has the molecular formula C26H19N3O and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-benzoyl-5-benzyl-1H-pyrido[4,3-b]indole-1-carbonitrile.
| Compound Name | 2-benzoyl-5-benzyl-1H-pyrido[4,3-b]indole-1-carbonitrile |
|---|---|
| PubChem CID | 171989629 |
| Molecular Formula | C26H19N3O |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 2-benzoyl-5-benzyl-1H-pyrido[4,3-b]indole-1-carbonitrile |
| SMILES | N#CC1c2c(n(Cc3ccccc3)c3ccccc23)C=CN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C26H19N3O/c27-17-24-25-21-13-7-8-14-22(21)29(18-19-9-3-1-4-10-19)23(25)15-16-28(24)26(30)20-11-5-2-6-12-20/h1-16,24H,18H2 |
| InChIKey | BLGOCQXVDXTNRY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |