C16H26BrNO3SSi — CID 171990025
(3S)-N-[(S)-(3-bromophenyl)sulfinyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide (PubChem CID 171990025) has the molecular formula C16H26BrNO3SSi and a molecular weight of 420.45 g/mol. Its IUPAC name is (3S)-N-[(S)-(3-bromophenyl)sulfinyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide.
| Compound Name | (3S)-N-[(S)-(3-bromophenyl)sulfinyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide |
|---|---|
| PubChem CID | 171990025 |
| Molecular Formula | C16H26BrNO3SSi |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | (3S)-N-[(S)-(3-bromophenyl)sulfinyl]-3-[tert-butyl(dimethyl)silyl]oxybutanamide |
| SMILES | C[C@@H](CC(=O)N[S@@](=O)c1cccc(Br)c1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H26BrNO3SSi/c1-12(21-23(5,6)16(2,3)4)10-15(19)18-22(20)14-9-7-8-13(17)11-14/h7-9,11-12H,10H2,1-6H3,(H,18,19)/t12-,22-/m0/s1 |
| InChIKey | CZWHTPNQMWNOHI-YTEVENLXSA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|