C17H28BrN3O2SSi — CID 164868889
1-[[3-(3-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-methylthiourea (PubChem CID 164868889) has the molecular formula C17H28BrN3O2SSi and a molecular weight of 446.49 g/mol. Its IUPAC name is 1-[[3-(3-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-methylthiourea.
| Compound Name | 1-[[3-(3-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 164868889 |
| Molecular Formula | C17H28BrN3O2SSi |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 1-[[3-(3-bromophenyl)-3-[tert-butyl(dimethyl)silyl]oxypropanoyl]amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)CC(O[Si](C)(C)C(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H28BrN3O2SSi/c1-17(2,3)25(5,6)23-14(12-8-7-9-13(18)10-12)11-15(22)20-21-16(24)19-4/h7-10,14H,11H2,1-6H3,(H,20,22)(H2,19,21,24) |
| InChIKey | RSUQEQAZKSNYCE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|