C17H18BrN3OS — CID 166078844
1-[[3-(3-bromophenyl)-3-phenylpropanoyl]amino]-3-methylthiourea (PubChem CID 166078844) has the molecular formula C17H18BrN3OS and a molecular weight of 392.32 g/mol. Its IUPAC name is 1-[[3-(3-bromophenyl)-3-phenylpropanoyl]amino]-3-methylthiourea.
| Compound Name | 1-[[3-(3-bromophenyl)-3-phenylpropanoyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 166078844 |
| Molecular Formula | C17H18BrN3OS |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 1-[[3-(3-bromophenyl)-3-phenylpropanoyl]amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)CC(c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H18BrN3OS/c1-19-17(23)21-20-16(22)11-15(12-6-3-2-4-7-12)13-8-5-9-14(18)10-13/h2-10,15H,11H2,1H3,(H,20,22)(H2,19,21,23) |
| InChIKey | XSAWBSBYOLFDLP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|