C23H19F3N6O2 — CID 171991036
3-[4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]phenyl]-1,2,4-oxadiazolidin-5-one (PubChem CID 171991036) has the molecular formula C23H19F3N6O2 and a molecular weight of 468.44 g/mol. Its IUPAC name is 3-[4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]phenyl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]phenyl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 171991036 |
| Molecular Formula | C23H19F3N6O2 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 3-[4-[6-[2-(4,5,7-trifluoro-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]phenyl]-1,2,4-oxadiazolidin-5-one |
| SMILES | Cc1cc2c(F)c(F)cc(F)c2n1CCNc1cc(-c2ccc(C3NOC(=O)N3)cc2)ncn1 |
| InChI | InChI=1S/C23H19F3N6O2/c1-12-8-15-20(26)16(24)9-17(25)21(15)32(12)7-6-27-19-10-18(28-11-29-19)13-2-4-14(5-3-13)22-30-23(33)34-31-22/h2-5,8-11,22,31H,6-7H2,1H3,(H,30,33)(H,27,28,29) |
| InChIKey | YYLBEEXKBPYGSZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|