C23H27FN6O2 — CID 171991042
6-[6-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]-1,2,3a,4,5,6,7,7a-octahydroindazol-3-one (PubChem CID 171991042) has the molecular formula C23H27FN6O2 and a molecular weight of 438.51 g/mol. Its IUPAC name is 6-[6-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]-1,2,3a,4,5,6,7,7a-octahydroindazol-3-one.
| Compound Name | 6-[6-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]-1,2,3a,4,5,6,7,7a-octahydroindazol-3-one |
|---|---|
| PubChem CID | 171991042 |
| Molecular Formula | C23H27FN6O2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 6-[6-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]pyrimidin-4-yl]-1,2,3a,4,5,6,7,7a-octahydroindazol-3-one |
| SMILES | COc1ccc(F)c2c1cc(C)n2CCNc1cc(C2CCC3C(=O)NNC3C2)ncn1 |
| InChI | InChI=1S/C23H27FN6O2/c1-13-9-16-20(32-2)6-5-17(24)22(16)30(13)8-7-25-21-11-18(26-12-27-21)14-3-4-15-19(10-14)28-29-23(15)31/h5-6,9,11-12,14-15,19,28H,3-4,7-8,10H2,1-2H3,(H,29,31)(H,25,26,27) |
| InChIKey | OEJLAFWXLPROMT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |